C23H30Cl2N6O4S — CID 142363320
3,5-dichloro-4-methylbenzenesulfonamide;methane;N,N,N',4-tetramethyl-6-oxo-2-[(2-oxo-1H-pyridin-4-yl)methyl]-1H-pyrimidine-5-carboximidamide (PubChem CID 142363320) has the molecular formula C23H30Cl2N6O4S and a molecular weight of 557.50 g/mol. Its IUPAC name is 3,5-dichloro-4-methylbenzenesulfonamide;methane;N,N,N',4-tetramethyl-6-oxo-2-[(2-oxo-1H-pyridin-4-yl)methyl]-1H-pyrimidine-5-carboximidamide.
| Compound Name | 3,5-dichloro-4-methylbenzenesulfonamide;methane;N,N,N',4-tetramethyl-6-oxo-2-[(2-oxo-1H-pyridin-4-yl)methyl]-1H-pyrimidine-5-carboximidamide |
|---|---|
| PubChem CID | 142363320 |
| Molecular Formula | C23H30Cl2N6O4S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 3,5-dichloro-4-methylbenzenesulfonamide;methane;N,N,N',4-tetramethyl-6-oxo-2-[(2-oxo-1H-pyridin-4-yl)methyl]-1H-pyrimidine-5-carboximidamide |
| SMILES | C.C/N=C(/c1c(C)nc(Cc2cc[nH]c(=O)c2)[nH]c1=O)N(C)C.Cc1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H19N5O2.C7H7Cl2NO2S.CH4/c1-9-13(14(16-2)20(3)4)15(22)19-11(18-9)7-10-5-6-17-12(21)8-10;1-4-6(8)2-5(3-7(4)9)13(10,11)12;/h5-6,8H,7H2,1-4H3,(H,17,21)(H,18,19,22);2-3H,1H3,(H2,10,11,12);1H4/b16-14-;; |
| InChIKey | GRNMMALAPWZADI-LVEHXPSQSA-N |
| XLogP | 2.88 |
| TPSA | 154.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|