C38H34BrNO — CID 142363351
N-(4-bromophenyl)-4-dibenzofuran-4-yl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline;ethane (PubChem CID 142363351) has the molecular formula C38H34BrNO and a molecular weight of 600.60 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-dibenzofuran-4-yl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline;ethane.
| Compound Name | N-(4-bromophenyl)-4-dibenzofuran-4-yl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline;ethane |
|---|---|
| PubChem CID | 142363351 |
| Molecular Formula | C38H34BrNO |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | N-(4-bromophenyl)-4-dibenzofuran-4-yl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline;ethane |
| SMILES | C/C=C\C(=C/C)c1ccc(N(c2ccc(Br)cc2)c2ccc(-c3cccc4c3oc3ccccc34)cc2)cc1.CC |
| InChI | InChI=1S/C36H28BrNO.C2H6/c1-3-8-25(4-2)26-13-19-29(20-14-26)38(31-23-17-28(37)18-24-31)30-21-15-27(16-22-30)32-10-7-11-34-33-9-5-6-12-35(33)39-36(32)34;1-2/h3-24H,1-2H3;1-2H3/b8-3-,25-4+; |
| InChIKey | DDJNNMVEKPQYHG-JYRTWJJUSA-N |
| XLogP | 12.49 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|