C20H35N3O10 — CID 142363831
2-acetamido-5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid (PubChem CID 142363831) has the molecular formula C20H35N3O10 and a molecular weight of 477.51 g/mol. Its IUPAC name is 2-acetamido-5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid.
| Compound Name | 2-acetamido-5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 142363831 |
| Molecular Formula | C20H35N3O10 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-acetamido-5-oxo-5-[2-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethylamino]pentanoic acid |
| SMILES | CC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C20H35N3O10/c1-15(24)13-32-11-9-31-8-6-22-19(27)14-33-12-10-30-7-5-21-18(26)4-3-17(20(28)29)23-16(2)25/h17H,3-14H2,1-2H3,(H,21,26)(H,22,27)(H,23,25)(H,28,29) |
| InChIKey | LNUMZJPCBFMYBP-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|