C21H38N2O2 — CID 142364751
ethane;[3-[3-[3-(3-methoxypiperidin-1-yl)propoxy]propyl]phenyl]methanamine (PubChem CID 142364751) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is ethane;[3-[3-[3-(3-methoxypiperidin-1-yl)propoxy]propyl]phenyl]methanamine.
| Compound Name | ethane;[3-[3-[3-(3-methoxypiperidin-1-yl)propoxy]propyl]phenyl]methanamine |
|---|---|
| PubChem CID | 142364751 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | ethane;[3-[3-[3-(3-methoxypiperidin-1-yl)propoxy]propyl]phenyl]methanamine |
| SMILES | CC.COC1CCCN(CCCOCCCc2cccc(CN)c2)C1 |
| InChI | InChI=1S/C19H32N2O2.C2H6/c1-22-19-9-3-10-21(16-19)11-5-13-23-12-4-8-17-6-2-7-18(14-17)15-20;1-2/h2,6-7,14,19H,3-5,8-13,15-16,20H2,1H3;1-2H3 |
| InChIKey | FCNXOVDXEHVGRD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|