About 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine
1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine (PubChem CID 142364812) has the molecular formula C15H30F2N2O3
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine.
Molecular Properties
| Compound Name | 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine |
| PubChem CID | 142364812 |
| Molecular Formula | C15H30F2N2O3 |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine |
| SMILES | COCCN1CCN(CCCCOCC(F)(F)COC)CC1 |
| InChI | InChI=1S/C15H30F2N2O3/c1-20-12-10-19-8-6-18(7-9-19)5-3-4-11-22-14-15(16,17)13-21-2/h3-14H2,1-2H3 |
| InChIKey | WLHPXDLTZMRISH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine?
The IUPAC name of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine (CID 142364812) is 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine.
What is the SMILES notation for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine?
The canonical SMILES for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine is COCCN1CCN(CCCCOCC(F)(F)COC)CC1.
What is the InChIKey of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine?
The InChIKey is WLHPXDLTZMRISH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30F2N2O3/c1-20-12-10-19-8-6-18(7-9-19)5-3-4-11-22-14-15(16,17)13-21-2/h3-14H2,1-2H3.
What are the key properties of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine?
1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine has a molecular weight of 324.41 g/mol, XLogP of 1.33, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]-4-(2-methoxyethyl)piperazine is sourced from PubChem (CID 142364812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).