C43H50N4O11 — CID 142364861
N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-4-[2-[2-[2-[2-[2-[2-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide (PubChem CID 142364861) has the molecular formula C43H50N4O11 and a molecular weight of 798.89 g/mol. Its IUPAC name is N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-4-[2-[2-[2-[2-[2-[2-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-4-[2-[2-[2-[2-[2-[2-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 142364861 |
| Molecular Formula | C43H50N4O11 |
| Molecular Weight | 798.89 g/mol |
| Exact Mass | 798.35 |
| IUPAC Name | N-(1,5-dioxopentan-2-yl)-2-formyl-N-methyl-4-[2-[2-[2-[2-[2-[2-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]benzamide |
| SMILES | CN(C(=O)c1ccc(OCCOCCOCCOCCOCCOCCOc2ccc(-c3ccc4c5cnccc5n(C)c4c3)cn2)cc1C=O)C(C=O)CCC=O |
| InChI | InChI=1S/C43H50N4O11/c1-46(35(31-50)4-3-13-48)43(51)37-9-7-36(26-34(37)30-49)57-24-22-55-20-18-53-16-14-52-15-17-54-19-21-56-23-25-58-42-10-6-33(28-45-42)32-5-8-38-39-29-44-12-11-40(39)47(2)41(38)27-32/h5-13,26-31,35H,3-4,14-25H2,1-2H3 |
| InChIKey | CZKPCGOPNPNTNO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 166.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.89 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|