About 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol
2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol (PubChem CID 142365051) has the molecular formula C14H29F2IN3O2-
and a molecular weight of 436.31 g/mol. Its IUPAC name is 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol |
| PubChem CID | 142365051 |
| Molecular Formula | C14H29F2IN3O2- |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol |
| SMILES | C[I-]NCC(F)(F)COCCCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C14H29F2IN3O2/c1-17-18-12-14(15,16)13-22-11-3-2-4-19-5-7-20(8-6-19)9-10-21/h18,21H,2-13H2,1H3/q-1 |
| InChIKey | FQTNDKCXZQSELO-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol (CID 142365051) is 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol is C[I-]NCC(F)(F)COCCCCN1CCN(CCO)CC1.
What is the InChIKey of 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol?
The InChIKey is FQTNDKCXZQSELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29F2IN3O2/c1-17-18-12-14(15,16)13-22-11-3-2-4-19-5-7-20(8-6-19)9-10-21/h18,21H,2-13H2,1H3/q-1.
What are the key properties of 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol?
2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol has a molecular weight of 436.31 g/mol, XLogP of -2.75, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-[2,2-difluoro-3-(methyliodanuidylamino)propoxy]butyl]piperazin-1-yl]ethanol is sourced from PubChem (CID 142365051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).