C22H36O2 — CID 14236522
(3S,5S,8R,9S,10S,13S,14S)-3-methoxy-10,13,16,16-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 14236522) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S)-3-methoxy-10,13,16,16-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S)-3-methoxy-10,13,16,16-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 14236522 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S)-3-methoxy-10,13,16,16-tetramethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)C(C)(C)C[C@@H]32)C1 |
| InChI | InChI=1S/C22H36O2/c1-20(2)13-18-16-7-6-14-12-15(24-5)8-10-21(14,3)17(16)9-11-22(18,4)19(20)23/h14-18H,6-13H2,1-5H3/t14-,15-,16+,17-,18-,21-,22-/m0/s1 |
| InChIKey | IZGFTAHESUHAEQ-HBVZMQQDSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |