C11H17N — CID 142365221
1,2,3,4a,5,5a-hexahydrocyclopropa[f]indole;ethane (PubChem CID 142365221) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 1,2,3,4a,5,5a-hexahydrocyclopropa[f]indole;ethane.
| Compound Name | 1,2,3,4a,5,5a-hexahydrocyclopropa[f]indole;ethane |
|---|---|
| PubChem CID | 142365221 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1,2,3,4a,5,5a-hexahydrocyclopropa[f]indole;ethane |
| SMILES | C1=C2CCNC2=CC2CC12.CC |
| InChI | InChI=1S/C9H11N.C2H6/c1-2-10-9-5-8-4-7(8)3-6(1)9;1-2/h3,5,7-8,10H,1-2,4H2;1-2H3 |
| InChIKey | JXFDRJLFMVCMMP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |