ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen

C8H23NO2 — CID 142365421

IUPACethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen
SMILESCC.CCOCCOCCN.[H][H]
InChIInChI=1S/C6H15NO2.C2H6.H2/c1-2-8-5-6-9-4-3-7;1-2;/h2-7H2,1H3;1-2H3;1H
InChIKeyFYVMCIZRUUAUCC-UHFFFAOYSA-N
MW165.28 g/mol
LogP1.27
Rot. Bonds6

About ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen

ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen (PubChem CID 142365421) has the molecular formula C8H23NO2 and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen.

Molecular Properties

Compound Nameethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen
PubChem CID142365421
Molecular FormulaC8H23NO2
Molecular Weight165.28 g/mol
Exact Mass165.17
IUPAC Nameethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen
SMILESCC.CCOCCOCCN.[H][H]
InChIInChI=1S/C6H15NO2.C2H6.H2/c1-2-8-5-6-9-4-3-7;1-2;/h2-7H2,1H3;1-2H3;1H
InChIKeyFYVMCIZRUUAUCC-UHFFFAOYSA-N
XLogP1.27
TPSA44.48 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.28
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen?
The IUPAC name of ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen (CID 142365421) is ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen.
What is the SMILES notation for ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen?
The canonical SMILES for ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen is CC.CCOCCOCCN.[H][H].
What is the InChIKey of ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen?
The InChIKey is FYVMCIZRUUAUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.C2H6.H2/c1-2-8-5-6-9-4-3-7;1-2;/h2-7H2,1H3;1-2H3;1H.
What are the key properties of ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen?
ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen has a molecular weight of 165.28 g/mol, XLogP of 1.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-ethoxyethoxy)ethanamine;molecular hydrogen is sourced from PubChem (CID 142365421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).