About 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen
3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen (PubChem CID 142367734) has the molecular formula C13H29F2N3O
and a molecular weight of 281.39 g/mol. Its IUPAC name is 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen |
| PubChem CID | 142367734 |
| Molecular Formula | C13H29F2N3O |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen |
| SMILES | CCN1CCN(CCCCOCC(F)(F)CN)CC1.[H][H] |
| InChI | InChI=1S/C13H27F2N3O.H2/c1-2-17-6-8-18(9-7-17)5-3-4-10-19-12-13(14,15)11-16;/h2-12,16H2,1H3;1H |
| InChIKey | MPLZHGOJVVLTLA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen?
The IUPAC name of 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen (CID 142367734) is 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen.
What is the SMILES notation for 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen?
The canonical SMILES for 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen is CCN1CCN(CCCCOCC(F)(F)CN)CC1.[H][H].
What is the InChIKey of 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen?
The InChIKey is MPLZHGOJVVLTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27F2N3O.H2/c1-2-17-6-8-18(9-7-17)5-3-4-10-19-12-13(14,15)11-16;/h2-12,16H2,1H3;1H.
What are the key properties of 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen?
3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen has a molecular weight of 281.39 g/mol, XLogP of 1.26, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-ethylpiperazin-1-yl)butoxy]-2,2-difluoropropan-1-amine;molecular hydrogen is sourced from PubChem (CID 142367734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).