About 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole
4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole (PubChem CID 142367938) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole |
| PubChem CID | 142367938 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole |
| SMILES | CC.Cc1cnoc1.Cc1ncoc1C |
| InChI | InChI=1S/C5H7NO.C4H5NO.C2H6/c1-4-5(2)7-3-6-4;1-4-2-5-6-3-4;1-2/h3H,1-2H3;2-3H,1H3;1-2H3 |
| InChIKey | OBORAEYOABTSBL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole?
The IUPAC name of 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole (CID 142367938) is 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole.
What is the SMILES notation for 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole?
The canonical SMILES for 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole is CC.Cc1cnoc1.Cc1ncoc1C.
What is the InChIKey of 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole?
The InChIKey is OBORAEYOABTSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO.C4H5NO.C2H6/c1-4-5(2)7-3-6-4;1-4-2-5-6-3-4;1-2/h3H,1-2H3;2-3H,1H3;1-2H3.
What are the key properties of 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole?
4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole has a molecular weight of 210.28 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,3-oxazole;ethane;4-methyl-1,2-oxazole is sourced from PubChem (CID 142367938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).