About 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane
1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane (PubChem CID 142368046) has the molecular formula C14H30F2N2O2
and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane.
Molecular Properties
| Compound Name | 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane |
| PubChem CID | 142368046 |
| Molecular Formula | C14H30F2N2O2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane |
| SMILES | CC.COCC(F)(F)COCCCCN1CCNCC1 |
| InChI | InChI=1S/C12H24F2N2O2.C2H6/c1-17-10-12(13,14)11-18-9-3-2-6-16-7-4-15-5-8-16;1-2/h15H,2-11H2,1H3;1-2H3 |
| InChIKey | NQFRLTWOHKDSAF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane?
The IUPAC name of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane (CID 142368046) is 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane.
What is the SMILES notation for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane?
The canonical SMILES for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane is CC.COCC(F)(F)COCCCCN1CCNCC1.
What is the InChIKey of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane?
The InChIKey is NQFRLTWOHKDSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24F2N2O2.C2H6/c1-17-10-12(13,14)11-18-9-3-2-6-16-7-4-15-5-8-16;1-2/h15H,2-11H2,1H3;1-2H3.
What are the key properties of 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane?
1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane has a molecular weight of 296.40 g/mol, XLogP of 2.00, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-difluoro-3-methoxypropoxy)butyl]piperazine;ethane is sourced from PubChem (CID 142368046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).