C44H47FN4O5 — CID 142368206
3-[6-[4-[5-[3-[2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 142368206) has the molecular formula C44H47FN4O5 and a molecular weight of 730.88 g/mol. Its IUPAC name is 3-[6-[4-[5-[3-[2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[5-[3-[2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 142368206 |
| Molecular Formula | C44H47FN4O5 |
| Molecular Weight | 730.88 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | 3-[6-[4-[5-[3-[2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]pentyl]piperazin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(CCCCCOc5cccc(C6c7ccc(O)cc7CCC6c6ccc(F)cc6)c5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C44H47FN4O5/c45-33-10-7-29(8-11-33)37-14-9-30-26-35(50)13-16-38(30)42(37)31-5-4-6-36(27-31)54-24-3-1-2-19-47-20-22-48(23-21-47)34-12-15-39-32(25-34)28-49(44(39)53)40-17-18-41(51)46-43(40)52/h4-8,10-13,15-16,25-27,37,40,42,50H,1-3,9,14,17-24,28H2,(H,46,51,52) |
| InChIKey | QIPGOEGKZBZDSR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.88 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|