C17H29NO — CID 142368757
1-(2-cyclohepta-1,3,6-trien-1-yloxyethyl)piperidine;propane (PubChem CID 142368757) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-(2-cyclohepta-1,3,6-trien-1-yloxyethyl)piperidine;propane.
| Compound Name | 1-(2-cyclohepta-1,3,6-trien-1-yloxyethyl)piperidine;propane |
|---|---|
| PubChem CID | 142368757 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(2-cyclohepta-1,3,6-trien-1-yloxyethyl)piperidine;propane |
| SMILES | C1=CCC=CC(OCCN2CCCCC2)=C1.CCC |
| InChI | InChI=1S/C14H21NO.C3H8/c1-2-5-9-14(8-4-1)16-13-12-15-10-6-3-7-11-15;1-3-2/h1,4-5,8-9H,2-3,6-7,10-13H2;3H2,1-2H3 |
| InChIKey | IWZOAWTXVHHDJY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |