About 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane
6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 142368833) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 142368833 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | CCOCCN1CC2(C1)CN(CCOC(C)C)C2 |
| InChI | InChI=1S/C14H28N2O2/c1-4-17-7-5-15-9-14(10-15)11-16(12-14)6-8-18-13(2)3/h13H,4-12H2,1-3H3 |
| InChIKey | IXPJPATXOIENTF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane?
The IUPAC name of 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane (CID 142368833) is 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane is CCOCCN1CC2(C1)CN(CCOC(C)C)C2.
What is the InChIKey of 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane?
The InChIKey is IXPJPATXOIENTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-4-17-7-5-15-9-14(10-15)11-16(12-14)6-8-18-13(2)3/h13H,4-12H2,1-3H3.
What are the key properties of 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane?
6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane has a molecular weight of 256.39 g/mol, XLogP of 1.07, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-ethoxyethyl)-2-(2-propan-2-yloxyethyl)-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 142368833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).