About 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane
6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane (PubChem CID 142369043) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane.
Molecular Properties
| Compound Name | 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane |
| PubChem CID | 142369043 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane |
| SMILES | CC.CCn1cc(C)c(=O)c2cc(N(C)C3Cc4ccccc4C3)cnc21 |
| InChI | InChI=1S/C21H23N3O.C2H6/c1-4-24-13-14(2)20(25)19-11-18(12-22-21(19)24)23(3)17-9-15-7-5-6-8-16(15)10-17;1-2/h5-8,11-13,17H,4,9-10H2,1-3H3;1-2H3 |
| InChIKey | IIVHAZWOVPPBKC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane?
The IUPAC name of 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane (CID 142369043) is 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane.
What is the SMILES notation for 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane?
The canonical SMILES for 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane is CC.CCn1cc(C)c(=O)c2cc(N(C)C3Cc4ccccc4C3)cnc21.
What is the InChIKey of 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane?
The InChIKey is IIVHAZWOVPPBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O.C2H6/c1-4-24-13-14(2)20(25)19-11-18(12-22-21(19)24)23(3)17-9-15-7-5-6-8-16(15)10-17;1-2/h5-8,11-13,17H,4,9-10H2,1-3H3;1-2H3.
What are the key properties of 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane?
6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane has a molecular weight of 363.51 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-1-ethyl-3-methyl-1,8-naphthyridin-4-one;ethane is sourced from PubChem (CID 142369043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).