2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid

C7H12O6 — CID 14236908

IUPAC2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid
SMILESO=C(O)C1CC(O)C(O)C(O)C1O
InChIInChI=1S/C7H12O6/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h2-6,8-11H,1H2,(H,12,13)
InChIKeyVFZFUKWNZRDVTB-UHFFFAOYSA-N
MW192.17 g/mol
LogP-2.47
Rot. Bonds1

About 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid

2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (PubChem CID 14236908) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid
PubChem CID14236908
Molecular FormulaC7H12O6
Molecular Weight192.17 g/mol
Exact Mass192.06
IUPAC Name2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid
SMILESO=C(O)C1CC(O)C(O)C(O)C1O
InChIInChI=1S/C7H12O6/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h2-6,8-11H,1H2,(H,12,13)
InChIKeyVFZFUKWNZRDVTB-UHFFFAOYSA-N
XLogP-2.47
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 5-2.47
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid?
The IUPAC name of 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid (CID 14236908) is 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid.
What is the SMILES notation for 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid?
The canonical SMILES for 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid is O=C(O)C1CC(O)C(O)C(O)C1O.
What is the InChIKey of 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid?
The InChIKey is VFZFUKWNZRDVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O6/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h2-6,8-11H,1H2,(H,12,13).
What are the key properties of 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid?
2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid has a molecular weight of 192.17 g/mol, XLogP of -2.47, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid is sourced from PubChem (CID 14236908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).