C21H22N4O4S — CID 142369261
7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one;formic acid (PubChem CID 142369261) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one;formic acid.
| Compound Name | 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one;formic acid |
|---|---|
| PubChem CID | 142369261 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one;formic acid |
| SMILES | Cc1cc(OC2CCCC2)ncc1N1C(=O)Nc2c(C)sc3nccc1c23.O=CO |
| InChI | InChI=1S/C20H20N4O2S.CH2O2/c1-11-9-16(26-13-5-3-4-6-13)22-10-15(11)24-14-7-8-21-19-17(14)18(12(2)27-19)23-20(24)25;2-1-3/h7-10,13H,3-6H2,1-2H3,(H,23,25);1H,(H,2,3) |
| InChIKey | BUTVUKWIPMCEKX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|