C31H27N5O4S — CID 142369270
N-[(1S,2Z)-2-[3-[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]oxiran-2-yl]iminocyclopentyl]prop-2-enamide (PubChem CID 142369270) has the molecular formula C31H27N5O4S and a molecular weight of 565.66 g/mol. Its IUPAC name is N-[(1S,2Z)-2-[3-[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]oxiran-2-yl]iminocyclopentyl]prop-2-enamide.
| Compound Name | N-[(1S,2Z)-2-[3-[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]oxiran-2-yl]iminocyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 142369270 |
| Molecular Formula | C31H27N5O4S |
| Molecular Weight | 565.66 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | N-[(1S,2Z)-2-[3-[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]oxiran-2-yl]iminocyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCC/C1=N/C1OC1c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C31H27N5O4S/c1-3-24(37)33-20-10-7-11-21(20)34-29-27(40-29)28-26-25-23(14-15-32-30(25)41-28)36(31(38)35-26)22-13-12-19(16-17(22)2)39-18-8-5-4-6-9-18/h3-6,8-9,12-16,20,27,29H,1,7,10-11H2,2H3,(H,33,37)(H,35,38)/b34-21-/t20-,27?,29?/m0/s1 |
| InChIKey | DJLWEFNNNQKFSZ-WXXUBGMCSA-N |
| XLogP | 6.77 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|