C21H38O2 — CID 14236955
(3Z,6Z,9Z)-1,1-di(propan-2-yloxy)pentadeca-3,6,9-triene (PubChem CID 14236955) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is (3Z,6Z,9Z)-1,1-di(propan-2-yloxy)pentadeca-3,6,9-triene.
| Compound Name | (3Z,6Z,9Z)-1,1-di(propan-2-yloxy)pentadeca-3,6,9-triene |
|---|---|
| PubChem CID | 14236955 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (3Z,6Z,9Z)-1,1-di(propan-2-yloxy)pentadeca-3,6,9-triene |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C21H38O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22-19(2)3)23-20(4)5/h10-11,13-14,16-17,19-21H,6-9,12,15,18H2,1-5H3/b11-10-,14-13-,17-16- |
| InChIKey | NHEMDOJCKNJLQE-NWFXIAEYSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|