About butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione
butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione (PubChem CID 142369756) has the molecular formula C17H24N2O6
and a molecular weight of 352.39 g/mol. Its IUPAC name is butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione |
| PubChem CID | 142369756 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione |
| SMILES | CN(C)OC(=C=O)CCCCCN1C(=O)C=CC1=O.O=CCCC=O |
| InChI | InChI=1S/C13H18N2O4.C4H6O2/c1-14(2)19-11(10-16)6-4-3-5-9-15-12(17)7-8-13(15)18;5-3-1-2-4-6/h7-8H,3-6,9H2,1-2H3;3-4H,1-2H2 |
| InChIKey | BKCREOZFSYXRII-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione?
The IUPAC name of butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione (CID 142369756) is butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione.
What is the SMILES notation for butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione?
The canonical SMILES for butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione is CN(C)OC(=C=O)CCCCCN1C(=O)C=CC1=O.O=CCCC=O.
What is the InChIKey of butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione?
The InChIKey is BKCREOZFSYXRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4.C4H6O2/c1-14(2)19-11(10-16)6-4-3-5-9-15-12(17)7-8-13(15)18;5-3-1-2-4-6/h7-8H,3-6,9H2,1-2H3;3-4H,1-2H2.
What are the key properties of butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione?
butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione has a molecular weight of 352.39 g/mol, XLogP of 0.84, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butanedial;1-[6-(dimethylaminooxy)-7-oxohept-6-enyl]pyrrole-2,5-dione is sourced from PubChem (CID 142369756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).