C22H36F2O — CID 142370465
2,3-difluoro-1-methoxy-4-(5,6,9-trimethyldodec-10-en-2-yl)cyclohexa-1,3-diene (PubChem CID 142370465) has the molecular formula C22H36F2O and a molecular weight of 354.53 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-(5,6,9-trimethyldodec-10-en-2-yl)cyclohexa-1,3-diene.
| Compound Name | 2,3-difluoro-1-methoxy-4-(5,6,9-trimethyldodec-10-en-2-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142370465 |
| Molecular Formula | C22H36F2O |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-(5,6,9-trimethyldodec-10-en-2-yl)cyclohexa-1,3-diene |
| SMILES | CC=CC(C)CCC(C)C(C)CCC(C)C1=C(F)C(F)=C(OC)CC1 |
| InChI | InChI=1S/C22H36F2O/c1-7-8-15(2)9-10-16(3)17(4)11-12-18(5)19-13-14-20(25-6)22(24)21(19)23/h7-8,15-18H,9-14H2,1-6H3 |
| InChIKey | TUFFZYUHVIXELX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|