C19H14F3N3O3S2 — CID 142370720
3-ethylsulfonyl-2-[5-(trifluoromethylsulfanyl)-1,3-benzoxazol-2-yl]quinolin-6-amine (PubChem CID 142370720) has the molecular formula C19H14F3N3O3S2 and a molecular weight of 453.47 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[5-(trifluoromethylsulfanyl)-1,3-benzoxazol-2-yl]quinolin-6-amine.
| Compound Name | 3-ethylsulfonyl-2-[5-(trifluoromethylsulfanyl)-1,3-benzoxazol-2-yl]quinolin-6-amine |
|---|---|
| PubChem CID | 142370720 |
| Molecular Formula | C19H14F3N3O3S2 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 3-ethylsulfonyl-2-[5-(trifluoromethylsulfanyl)-1,3-benzoxazol-2-yl]quinolin-6-amine |
| SMILES | CCS(=O)(=O)c1cc2cc(N)ccc2nc1-c1nc2cc(SC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C19H14F3N3O3S2/c1-2-30(26,27)16-8-10-7-11(23)3-5-13(10)24-17(16)18-25-14-9-12(29-19(20,21)22)4-6-15(14)28-18/h3-9H,2,23H2,1H3 |
| InChIKey | IDZHTLNFXXOZMR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|