About 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane
3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane (PubChem CID 142371414) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane |
| PubChem CID | 142371414 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane |
| SMILES | C=C/C=C\N=C(/CC)C(CCC)N(C)C.CC.CC |
| InChI | InChI=1S/C13H24N2.2C2H6/c1-6-9-11-14-12(8-3)13(10-7-2)15(4)5;2*1-2/h6,9,11,13H,1,7-8,10H2,2-5H3;2*1-2H3/b11-9-,14-12+;; |
| InChIKey | YOCRADOWVDKTBZ-LXPAZSHRSA-N |
| XLogP | 5.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane (CID 142371414) is 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane is C=C/C=C\N=C(/CC)C(CCC)N(C)C.CC.CC.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane?
The InChIKey is YOCRADOWVDKTBZ-LXPAZSHRSA-N. The full InChI is InChI=1S/C13H24N2.2C2H6/c1-6-9-11-14-12(8-3)13(10-7-2)15(4)5;2*1-2/h6,9,11,13H,1,7-8,10H2,2-5H3;2*1-2H3/b11-9-,14-12+;;.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane?
3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane has a molecular weight of 268.49 g/mol, XLogP of 5.32, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]imino-N,N-dimethylheptan-4-amine;ethane is sourced from PubChem (CID 142371414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).