C18H19F2N5O — CID 142371440
3-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-1-N-(2-methoxyethyl)-5-methylbenzene-1,3-diamine (PubChem CID 142371440) has the molecular formula C18H19F2N5O and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-1-N-(2-methoxyethyl)-5-methylbenzene-1,3-diamine.
| Compound Name | 3-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-1-N-(2-methoxyethyl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 142371440 |
| Molecular Formula | C18H19F2N5O |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 3-N-[1-(3,5-difluorophenyl)-1,2,4-triazol-3-yl]-1-N-(2-methoxyethyl)-5-methylbenzene-1,3-diamine |
| SMILES | COCCNc1cc(C)cc(Nc2ncn(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C18H19F2N5O/c1-12-5-15(21-3-4-26-2)10-16(6-12)23-18-22-11-25(24-18)17-8-13(19)7-14(20)9-17/h5-11,21H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | UDQCWUSYGNCKPB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|