About ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane
ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane (PubChem CID 142371455) has the molecular formula C20H27N5O
and a molecular weight of 353.47 g/mol. Its IUPAC name is ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane.
Molecular Properties
| Compound Name | ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane |
| PubChem CID | 142371455 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane |
| SMILES | C1CCOC1.CC.Cc1ncccc1Nc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H13N5.C4H8O.C2H6/c1-11-13(8-5-9-15-11)17-14-16-10-19(18-14)12-6-3-2-4-7-12;1-2-4-5-3-1;1-2/h2-10H,1H3,(H,17,18);1-4H2;1-2H3 |
| InChIKey | GHCFJUMUDZPRPD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane?
The IUPAC name of ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane (CID 142371455) is ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane.
What is the SMILES notation for ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane?
The canonical SMILES for ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane is C1CCOC1.CC.Cc1ncccc1Nc1ncn(-c2ccccc2)n1.
What is the InChIKey of ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane?
The InChIKey is GHCFJUMUDZPRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5.C4H8O.C2H6/c1-11-13(8-5-9-15-11)17-14-16-10-19(18-14)12-6-3-2-4-7-12;1-2-4-5-3-1;1-2/h2-10H,1H3,(H,17,18);1-4H2;1-2H3.
What are the key properties of ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane?
ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane has a molecular weight of 353.47 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-N-(1-phenyl-1,2,4-triazol-3-yl)pyridin-3-amine;oxolane is sourced from PubChem (CID 142371455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).