C16H19FS — CID 142371629
2-fluoro-5-[(E)-1-penta-1,4-dien-2-ylsulfanylbut-1-en-2-yl]cyclohepta-1,3,5-triene (PubChem CID 142371629) has the molecular formula C16H19FS and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-fluoro-5-[(E)-1-penta-1,4-dien-2-ylsulfanylbut-1-en-2-yl]cyclohepta-1,3,5-triene.
| Compound Name | 2-fluoro-5-[(E)-1-penta-1,4-dien-2-ylsulfanylbut-1-en-2-yl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142371629 |
| Molecular Formula | C16H19FS |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-fluoro-5-[(E)-1-penta-1,4-dien-2-ylsulfanylbut-1-en-2-yl]cyclohepta-1,3,5-triene |
| SMILES | C=CCC(=C)S/C=C(\CC)C1=CCC=C(F)C=C1 |
| InChI | InChI=1S/C16H19FS/c1-4-7-13(3)18-12-14(5-2)15-8-6-9-16(17)11-10-15/h4,8-12H,1,3,5-7H2,2H3/b14-12+ |
| InChIKey | LYMPZOJUFSWGQM-WYMLVPIESA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|