C28H42F2N2 — CID 142371693
4-[(4E,5Z,7E)-4-ethylidene-8-fluoronona-5,7-dien-3-yl]-1-[[3-fluoro-1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]azetidin-3-yl]methyl]piperidine (PubChem CID 142371693) has the molecular formula C28H42F2N2 and a molecular weight of 444.65 g/mol. Its IUPAC name is 4-[(4E,5Z,7E)-4-ethylidene-8-fluoronona-5,7-dien-3-yl]-1-[[3-fluoro-1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]azetidin-3-yl]methyl]piperidine.
| Compound Name | 4-[(4E,5Z,7E)-4-ethylidene-8-fluoronona-5,7-dien-3-yl]-1-[[3-fluoro-1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]azetidin-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 142371693 |
| Molecular Formula | C28H42F2N2 |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | 4-[(4E,5Z,7E)-4-ethylidene-8-fluoronona-5,7-dien-3-yl]-1-[[3-fluoro-1-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]azetidin-3-yl]methyl]piperidine |
| SMILES | C/C=C\C(C)=C/C=C/N1CC(F)(CN2CCC(C(CC)C(/C=C\C=C(/C)F)=C/C)CC2)C1 |
| InChI | InChI=1S/C28H42F2N2/c1-6-11-23(4)12-10-17-32-21-28(30,22-32)20-31-18-15-26(16-19-31)27(8-3)25(7-2)14-9-13-24(5)29/h6-7,9-14,17,26-27H,8,15-16,18-22H2,1-5H3/b11-6-,14-9-,17-10+,23-12-,24-13+,25-7+ |
| InChIKey | STQJOGISSOUWTF-KOXQYQGVSA-N |
| XLogP | 7.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|