C32H55NO — CID 142371723
4-[(E)-3-ethyl-5-[(Z)-prop-1-enyl]-4-propyloct-5-en-4-yl]-1-[3-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypropyl]piperidine (PubChem CID 142371723) has the molecular formula C32H55NO and a molecular weight of 469.80 g/mol. Its IUPAC name is 4-[(E)-3-ethyl-5-[(Z)-prop-1-enyl]-4-propyloct-5-en-4-yl]-1-[3-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypropyl]piperidine.
| Compound Name | 4-[(E)-3-ethyl-5-[(Z)-prop-1-enyl]-4-propyloct-5-en-4-yl]-1-[3-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypropyl]piperidine |
|---|---|
| PubChem CID | 142371723 |
| Molecular Formula | C32H55NO |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.43 |
| IUPAC Name | 4-[(E)-3-ethyl-5-[(Z)-prop-1-enyl]-4-propyloct-5-en-4-yl]-1-[3-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]oxypropyl]piperidine |
| SMILES | C=C/C(C)=C\C=C(/C)OCCCN1CCC(C(CCC)(C(/C=C\C)=C/CC)C(CC)CC)CC1 |
| InChI | InChI=1S/C32H55NO/c1-9-16-30(17-10-2)32(22-11-3,29(13-5)14-6)31-20-24-33(25-21-31)23-15-26-34-28(8)19-18-27(7)12-4/h9,12,16-19,29,31H,4,10-11,13-15,20-26H2,1-3,5-8H3/b16-9-,27-18-,28-19+,30-17+ |
| InChIKey | MAYAHJMXIOPNMZ-WNEXUELZSA-N |
| XLogP | 9.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|