About cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine
cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine (PubChem CID 142371922) has the molecular formula C16H33N3
and a molecular weight of 267.46 g/mol. Its IUPAC name is cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine.
Molecular Properties
| Compound Name | cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine |
| PubChem CID | 142371922 |
| Molecular Formula | C16H33N3 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.27 |
| IUPAC Name | cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine |
| SMILES | C1CCCCC1.C=C(NCC(=C)N(C)C)C(C)NC |
| InChI | InChI=1S/C10H21N3.C6H12/c1-8(13(5)6)7-12-10(3)9(2)11-4;1-2-4-6-5-3-1/h9,11-12H,1,3,7H2,2,4-6H3;1-6H2 |
| InChIKey | ZNFSGTXSPMICLK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine?
The IUPAC name of cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine (CID 142371922) is cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine.
What is the SMILES notation for cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine?
The canonical SMILES for cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine is C1CCCCC1.C=C(NCC(=C)N(C)C)C(C)NC.
What is the InChIKey of cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine?
The InChIKey is ZNFSGTXSPMICLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3.C6H12/c1-8(13(5)6)7-12-10(3)9(2)11-4;1-2-4-6-5-3-1/h9,11-12H,1,3,7H2,2,4-6H3;1-6H2.
What are the key properties of cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine?
cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine has a molecular weight of 267.46 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-N-[2-(dimethylamino)prop-2-enyl]-3-N-methylbut-1-ene-2,3-diamine is sourced from PubChem (CID 142371922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).