About 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile
1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile (PubChem CID 142372443) has the molecular formula C16H21F2N3O
and a molecular weight of 309.36 g/mol. Its IUPAC name is 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile |
| PubChem CID | 142372443 |
| Molecular Formula | C16H21F2N3O |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile |
| SMILES | CC(F)F.CCC(c1cncc(C#N)c1)N1CCC(C)C1=O |
| InChI | InChI=1S/C14H17N3O.C2H4F2/c1-3-13(17-5-4-10(2)14(17)18)12-6-11(7-15)8-16-9-12;1-2(3)4/h6,8-10,13H,3-5H2,1-2H3;2H,1H3 |
| InChIKey | JUBOWDPXTZUZJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile?
The IUPAC name of 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile (CID 142372443) is 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile.
What is the SMILES notation for 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile?
The canonical SMILES for 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile is CC(F)F.CCC(c1cncc(C#N)c1)N1CCC(C)C1=O.
What is the InChIKey of 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile?
The InChIKey is JUBOWDPXTZUZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O.C2H4F2/c1-3-13(17-5-4-10(2)14(17)18)12-6-11(7-15)8-16-9-12;1-2(3)4/h6,8-10,13H,3-5H2,1-2H3;2H,1H3.
What are the key properties of 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile?
1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile has a molecular weight of 309.36 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethane;5-[1-(3-methyl-2-oxopyrrolidin-1-yl)propyl]pyridine-3-carbonitrile is sourced from PubChem (CID 142372443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).