C12H16N2O4 — CID 142373429
4-ethenyl-3-[(E)-2-nitroprop-1-enyl]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine (PubChem CID 142373429) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-ethenyl-3-[(E)-2-nitroprop-1-enyl]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine.
| Compound Name | 4-ethenyl-3-[(E)-2-nitroprop-1-enyl]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine |
|---|---|
| PubChem CID | 142373429 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-ethenyl-3-[(E)-2-nitroprop-1-enyl]-6,7,9,9a-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazine |
| SMILES | C=CC1=C(/C=C(\C)[N+](=O)[O-])OCC2COCCN12 |
| InChI | InChI=1S/C12H16N2O4/c1-3-11-12(6-9(2)14(15)16)18-8-10-7-17-5-4-13(10)11/h3,6,10H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | VWGAYDPWVZIQII-RMKNXTFCSA-N |
| XLogP | 1.30 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|