C30H35N7O4 — CID 142373476
N-[7-(hydroxyamino)-7-oxoheptyl]-3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]benzamide (PubChem CID 142373476) has the molecular formula C30H35N7O4 and a molecular weight of 557.66 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]benzamide |
|---|---|
| PubChem CID | 142373476 |
| Molecular Formula | C30H35N7O4 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-3-[8-(4-morpholin-4-ylanilino)imidazo[1,2-a]pyrazin-6-yl]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1cccc(-c2cn3ccnc3c(Nc3ccc(N4CCOCC4)cc3)n2)c1)NO |
| InChI | InChI=1S/C30H35N7O4/c38-27(35-40)8-3-1-2-4-13-32-30(39)23-7-5-6-22(20-23)26-21-37-15-14-31-29(37)28(34-26)33-24-9-11-25(12-10-24)36-16-18-41-19-17-36/h5-7,9-12,14-15,20-21,40H,1-4,8,13,16-19H2,(H,32,39)(H,33,34)(H,35,38) |
| InChIKey | JIHUQKBATKHGCP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|