About 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole
2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole (PubChem CID 142373876) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole |
| PubChem CID | 142373876 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole |
| SMILES | C=Cc1c(/C=C\CC)n(C)c2c1=CCCC(C)C=2 |
| InChI | InChI=1S/C17H23N/c1-5-7-11-16-14(6-2)15-10-8-9-13(3)12-17(15)18(16)4/h6-7,10-13H,2,5,8-9H2,1,3-4H3/b11-7- |
| InChIKey | XYYOXOSNORBAFB-XFFZJAGNSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole?
The IUPAC name of 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole (CID 142373876) is 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole.
What is the SMILES notation for 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole?
The canonical SMILES for 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole is C=Cc1c(/C=C\CC)n(C)c2c1=CCCC(C)C=2.
What is the InChIKey of 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole?
The InChIKey is XYYOXOSNORBAFB-XFFZJAGNSA-N. The full InChI is InChI=1S/C17H23N/c1-5-7-11-16-14(6-2)15-10-8-9-13(3)12-17(15)18(16)4/h6-7,10-13H,2,5,8-9H2,1,3-4H3/b11-7-.
What are the key properties of 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole?
2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole has a molecular weight of 241.38 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-but-1-enyl]-3-ethenyl-1,7-dimethyl-6,7-dihydro-5H-cyclohepta[b]pyrrole is sourced from PubChem (CID 142373876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).