About ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane
ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane (PubChem CID 142374192) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane.
Molecular Properties
| Compound Name | ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane |
| PubChem CID | 142374192 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane |
| SMILES | CC.CCC.O=C1OC(OO)c2ccccc21 |
| InChI | InChI=1S/C8H6O4.C3H8.C2H6/c9-7-5-3-1-2-4-6(5)8(11-7)12-10;1-3-2;1-2/h1-4,8,10H;3H2,1-2H3;1-2H3 |
| InChIKey | LVOOIBLVAFBYJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane?
The IUPAC name of ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane (CID 142374192) is ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane.
What is the SMILES notation for ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane?
The canonical SMILES for ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane is CC.CCC.O=C1OC(OO)c2ccccc21.
What is the InChIKey of ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane?
The InChIKey is LVOOIBLVAFBYJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C3H8.C2H6/c9-7-5-3-1-2-4-6(5)8(11-7)12-10;1-3-2;1-2/h1-4,8,10H;3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane?
ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane has a molecular weight of 240.30 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-hydroperoxy-3H-2-benzofuran-1-one;propane is sourced from PubChem (CID 142374192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).