C14H20ClN3 — CID 142374334
2-[3-(3-chloro-4-methylphenyl)pyrazol-1-yl]ethanamine;ethane (PubChem CID 142374334) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 2-[3-(3-chloro-4-methylphenyl)pyrazol-1-yl]ethanamine;ethane.
| Compound Name | 2-[3-(3-chloro-4-methylphenyl)pyrazol-1-yl]ethanamine;ethane |
|---|---|
| PubChem CID | 142374334 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-[3-(3-chloro-4-methylphenyl)pyrazol-1-yl]ethanamine;ethane |
| SMILES | CC.Cc1ccc(-c2ccn(CCN)n2)cc1Cl |
| InChI | InChI=1S/C12H14ClN3.C2H6/c1-9-2-3-10(8-11(9)13)12-4-6-16(15-12)7-5-14;1-2/h2-4,6,8H,5,7,14H2,1H3;1-2H3 |
| InChIKey | DPDMNACINARVLL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |