About (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane
(Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane (PubChem CID 142374868) has the molecular formula C11H18F3N
and a molecular weight of 221.27 g/mol. Its IUPAC name is (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane.
Molecular Properties
| Compound Name | (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane |
| PubChem CID | 142374868 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane |
| SMILES | C/C=C\C(=N\C(C)=C/C)C(F)(F)F.CC |
| InChI | InChI=1S/C9H12F3N.C2H6/c1-4-6-8(9(10,11)12)13-7(3)5-2;1-2/h4-6H,1-3H3;1-2H3/b6-4-,7-5-,13-8-; |
| InChIKey | MQQGBVQDSDCHTI-MLNZJGKDSA-N |
| XLogP | 4.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane?
The IUPAC name of (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane (CID 142374868) is (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane.
What is the SMILES notation for (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane?
The canonical SMILES for (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane is C/C=C\C(=N\C(C)=C/C)C(F)(F)F.CC.
What is the InChIKey of (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane?
The InChIKey is MQQGBVQDSDCHTI-MLNZJGKDSA-N. The full InChI is InChI=1S/C9H12F3N.C2H6/c1-4-6-8(9(10,11)12)13-7(3)5-2;1-2/h4-6H,1-3H3;1-2H3/b6-4-,7-5-,13-8-;.
What are the key properties of (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane?
(Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane has a molecular weight of 221.27 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(Z)-but-2-en-2-yl]-1,1,1-trifluoropent-3-en-2-imine;ethane is sourced from PubChem (CID 142374868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).