C16H26O4 — CID 14237493
(6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl) octanoate (PubChem CID 14237493) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl) octanoate.
| Compound Name | (6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl) octanoate |
|---|---|
| PubChem CID | 14237493 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (6-hydroxy-3,6,7,7a-tetrahydro-2H-1-benzofuran-3a-yl) octanoate |
| SMILES | CCCCCCCC(=O)OC12C=CC(O)CC1OCC2 |
| InChI | InChI=1S/C16H26O4/c1-2-3-4-5-6-7-15(18)20-16-9-8-13(17)12-14(16)19-11-10-16/h8-9,13-14,17H,2-7,10-12H2,1H3 |
| InChIKey | AINNINVYAFDFKK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|