C29H38N4O4S2 — CID 142376186
(3R)-3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[5-methyl-4-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]thiophen-2-yl]propanoic acid (PubChem CID 142376186) has the molecular formula C29H38N4O4S2 and a molecular weight of 570.78 g/mol. Its IUPAC name is (3R)-3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[5-methyl-4-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]thiophen-2-yl]propanoic acid.
| Compound Name | (3R)-3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[5-methyl-4-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]thiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 142376186 |
| Molecular Formula | C29H38N4O4S2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (3R)-3-[4-[amino(ethyl)amino]-2-methyl-3-(methylamino)phenyl]-2,2-dimethyl-3-[5-methyl-4-[(1-oxo-3,4-dihydro-5,1λ4,2-benzoxathiazepin-2-yl)methyl]thiophen-2-yl]propanoic acid |
| SMILES | CCN(N)c1ccc([C@@H](c2cc(CN3CCOc4ccccc4S3=O)c(C)s2)C(C)(C)C(=O)O)c(C)c1NC |
| InChI | InChI=1S/C29H38N4O4S2/c1-7-33(30)22-13-12-21(18(2)27(22)31-6)26(29(4,5)28(34)35)24-16-20(19(3)38-24)17-32-14-15-37-23-10-8-9-11-25(23)39(32)36/h8-13,16,26,31H,7,14-15,17,30H2,1-6H3,(H,34,35)/t26-,39?/m0/s1 |
| InChIKey | QBCFIRIWNGAMJH-APBQMGQJSA-N |
| XLogP | 5.27 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|