C20H33N3O2S — CID 142376644
(Z)-6,7-diamino-3-[3-[[ethyl(methylsulfanyl)amino]methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoic acid (PubChem CID 142376644) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is (Z)-6,7-diamino-3-[3-[[ethyl(methylsulfanyl)amino]methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoic acid.
| Compound Name | (Z)-6,7-diamino-3-[3-[[ethyl(methylsulfanyl)amino]methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoic acid |
|---|---|
| PubChem CID | 142376644 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (Z)-6,7-diamino-3-[3-[[ethyl(methylsulfanyl)amino]methyl]-4-methylphenyl]-2,2-dimethylhept-6-enoic acid |
| SMILES | CCN(Cc1cc(C(CC/C(N)=C/N)C(C)(C)C(=O)O)ccc1C)SC |
| InChI | InChI=1S/C20H33N3O2S/c1-6-23(26-5)13-16-11-15(8-7-14(16)2)18(10-9-17(22)12-21)20(3,4)19(24)25/h7-8,11-12,18H,6,9-10,13,21-22H2,1-5H3,(H,24,25)/b17-12- |
| InChIKey | LBLKVQJRBBOUDI-ATVHPVEESA-N |
| XLogP | 3.83 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|