C46H38O4 — CID 142377594
7-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-[(1Z,4Z,6E,8E,10Z)-8-methyl-6-phenylcycloundeca-1,4,6,8,10-pentaen-1-yl]naphthalen-1-yl]-4-methyldibenzofuran-1,2,3-triol (PubChem CID 142377594) has the molecular formula C46H38O4 and a molecular weight of 654.81 g/mol. Its IUPAC name is 7-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-[(1Z,4Z,6E,8E,10Z)-8-methyl-6-phenylcycloundeca-1,4,6,8,10-pentaen-1-yl]naphthalen-1-yl]-4-methyldibenzofuran-1,2,3-triol.
| Compound Name | 7-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-[(1Z,4Z,6E,8E,10Z)-8-methyl-6-phenylcycloundeca-1,4,6,8,10-pentaen-1-yl]naphthalen-1-yl]-4-methyldibenzofuran-1,2,3-triol |
|---|---|
| PubChem CID | 142377594 |
| Molecular Formula | C46H38O4 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 7-[2-[(1Z)-buta-1,3-dienyl]-3-methyl-4-[(1Z,4Z,6E,8E,10Z)-8-methyl-6-phenylcycloundeca-1,4,6,8,10-pentaen-1-yl]naphthalen-1-yl]-4-methyldibenzofuran-1,2,3-triol |
| SMILES | C=C/C=C\c1c(C)c(C2=C\C/C=C\C(c3ccccc3)=C/C(C)=C/C=C\2)c2ccccc2c1-c1ccc2c(c1)oc1c(C)c(O)c(O)c(O)c12 |
| InChI | InChI=1S/C46H38O4/c1-5-6-21-35-29(3)40(32-18-10-11-19-33(26-28(2)15-14-20-32)31-16-8-7-9-17-31)36-22-12-13-23-37(36)41(35)34-24-25-38-39(27-34)50-46-30(4)43(47)45(49)44(48)42(38)46/h5-9,11-27,47-49H,1,10H2,2-4H3/b19-11-,20-14-,21-6-,28-15+,32-18-,33-26+ |
| InChIKey | MNPUMYKICBRZOX-ZVDVJUBWSA-N |
| XLogP | 12.27 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|