C30H25N — CID 142377788
2-(3-cyclohexa-2,4-dien-1-yl-5-phenylphenyl)-2,9-dihydro-1H-carbazole (PubChem CID 142377788) has the molecular formula C30H25N and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(3-cyclohexa-2,4-dien-1-yl-5-phenylphenyl)-2,9-dihydro-1H-carbazole.
| Compound Name | 2-(3-cyclohexa-2,4-dien-1-yl-5-phenylphenyl)-2,9-dihydro-1H-carbazole |
|---|---|
| PubChem CID | 142377788 |
| Molecular Formula | C30H25N |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-(3-cyclohexa-2,4-dien-1-yl-5-phenylphenyl)-2,9-dihydro-1H-carbazole |
| SMILES | C1=CCC(c2cc(-c3ccccc3)cc(C3C=Cc4c([nH]c5ccccc45)C3)c2)C=C1 |
| InChI | InChI=1S/C30H25N/c1-3-9-21(10-4-1)24-17-25(22-11-5-2-6-12-22)19-26(18-24)23-15-16-28-27-13-7-8-14-29(27)31-30(28)20-23/h1-11,13-19,22-23,31H,12,20H2 |
| InChIKey | HVULBAYQLLJXHF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |