C20H26O3 — CID 142378194
(1R,7aR,9E,11aS)-9-benzylidene-1,7a-dimethyl-1,3,4,6,7,10,11,11a-octahydrobenzo[f][1,4]dioxonin-8-one (PubChem CID 142378194) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is (1R,7aR,9E,11aS)-9-benzylidene-1,7a-dimethyl-1,3,4,6,7,10,11,11a-octahydrobenzo[f][1,4]dioxonin-8-one.
| Compound Name | (1R,7aR,9E,11aS)-9-benzylidene-1,7a-dimethyl-1,3,4,6,7,10,11,11a-octahydrobenzo[f][1,4]dioxonin-8-one |
|---|---|
| PubChem CID | 142378194 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1R,7aR,9E,11aS)-9-benzylidene-1,7a-dimethyl-1,3,4,6,7,10,11,11a-octahydrobenzo[f][1,4]dioxonin-8-one |
| SMILES | C[C@H]1OCCOCC[C@@]2(C)C(=O)/C(=C/c3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C20H26O3/c1-15-18-9-8-17(14-16-6-4-3-5-7-16)19(21)20(18,2)10-11-22-12-13-23-15/h3-7,14-15,18H,8-13H2,1-2H3/b17-14+/t15-,18-,20-/m1/s1 |
| InChIKey | CJHUZVZAKSAUNZ-DLSVLEOPSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|