C34H27FN4O — CID 142378233
(6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile (PubChem CID 142378233) has the molecular formula C34H27FN4O and a molecular weight of 526.62 g/mol. Its IUPAC name is (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 142378233 |
| Molecular Formula | C34H27FN4O |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (6aR,7R,10aS)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-7-methyl-8-oxo-10a-phenyl-5,6,6a,7-tetrahydrobenzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@H]1C(=O)C(C#N)=C[C@@]2(c3ccccc3)c3nc(-c4ccnc(C5CC5)c4)nc(-c4ccccc4F)c3CC[C@H]12 |
| InChI | InChI=1S/C34H27FN4O/c1-20-27-14-13-26-30(25-9-5-6-10-28(25)35)38-33(22-15-16-37-29(17-22)21-11-12-21)39-32(26)34(27,18-23(19-36)31(20)40)24-7-3-2-4-8-24/h2-10,15-18,20-21,27H,11-14H2,1H3/t20-,27-,34+/m1/s1 |
| InChIKey | HFMPPZFFHRGCAS-RLABKUHLSA-N |
| XLogP | 6.74 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |