C33H35FN4O2 — CID 142378373
(6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-hydroxy-7-(3-hydroxypropyl)-6a,7,10a-trimethyl-6,10-dihydro-5H-benzo[h]quinazoline-9-carbonitrile (PubChem CID 142378373) has the molecular formula C33H35FN4O2 and a molecular weight of 538.67 g/mol. Its IUPAC name is (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-hydroxy-7-(3-hydroxypropyl)-6a,7,10a-trimethyl-6,10-dihydro-5H-benzo[h]quinazoline-9-carbonitrile.
| Compound Name | (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-hydroxy-7-(3-hydroxypropyl)-6a,7,10a-trimethyl-6,10-dihydro-5H-benzo[h]quinazoline-9-carbonitrile |
|---|---|
| PubChem CID | 142378373 |
| Molecular Formula | C33H35FN4O2 |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (6aS,7R,10aR)-2-(2-cyclopropyl-4-pyridinyl)-4-(2-fluorophenyl)-8-hydroxy-7-(3-hydroxypropyl)-6a,7,10a-trimethyl-6,10-dihydro-5H-benzo[h]quinazoline-9-carbonitrile |
| SMILES | C[C@]12CCc3c(-c4ccccc4F)nc(-c4ccnc(C5CC5)c4)nc3[C@]1(C)CC(C#N)=C(O)[C@]2(C)CCCO |
| InChI | InChI=1S/C33H35FN4O2/c1-31(13-6-16-39)29(40)22(19-35)18-32(2)28-24(11-14-33(31,32)3)27(23-7-4-5-8-25(23)34)37-30(38-28)21-12-15-36-26(17-21)20-9-10-20/h4-5,7-8,12,15,17,20,39-40H,6,9-11,13-14,16,18H2,1-3H3/t31-,32-,33+/m0/s1 |
| InChIKey | RNYNQXQSPDBSGT-XFCANUNOSA-N |
| XLogP | 6.95 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |