About ethane;1-propan-2-ylpyrazolidine-3,5-dione
ethane;1-propan-2-ylpyrazolidine-3,5-dione (PubChem CID 142378494) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is ethane;1-propan-2-ylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | ethane;1-propan-2-ylpyrazolidine-3,5-dione |
| PubChem CID | 142378494 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | ethane;1-propan-2-ylpyrazolidine-3,5-dione |
| SMILES | CC.CC(C)N1NC(=O)CC1=O |
| InChI | InChI=1S/C6H10N2O2.C2H6/c1-4(2)8-6(10)3-5(9)7-8;1-2/h4H,3H2,1-2H3,(H,7,9);1-2H3 |
| InChIKey | CPTVBZDJYCABRA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-propan-2-ylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-ylpyrazolidine-3,5-dione?
The IUPAC name of ethane;1-propan-2-ylpyrazolidine-3,5-dione (CID 142378494) is ethane;1-propan-2-ylpyrazolidine-3,5-dione.
What is the SMILES notation for ethane;1-propan-2-ylpyrazolidine-3,5-dione?
The canonical SMILES for ethane;1-propan-2-ylpyrazolidine-3,5-dione is CC.CC(C)N1NC(=O)CC1=O.
What is the InChIKey of ethane;1-propan-2-ylpyrazolidine-3,5-dione?
The InChIKey is CPTVBZDJYCABRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2.C2H6/c1-4(2)8-6(10)3-5(9)7-8;1-2/h4H,3H2,1-2H3,(H,7,9);1-2H3.
What are the key properties of ethane;1-propan-2-ylpyrazolidine-3,5-dione?
ethane;1-propan-2-ylpyrazolidine-3,5-dione has a molecular weight of 172.23 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-ylpyrazolidine-3,5-dione is sourced from PubChem (CID 142378494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).