C12H21NO — CID 142378623
(3S,4R)-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-(methoxymethyl)pyrrolidine;molecular hydrogen (PubChem CID 142378623) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3S,4R)-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-(methoxymethyl)pyrrolidine;molecular hydrogen.
| Compound Name | (3S,4R)-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-(methoxymethyl)pyrrolidine;molecular hydrogen |
|---|---|
| PubChem CID | 142378623 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3S,4R)-3-[(3Z)-hexa-1,3,5-trien-2-yl]-4-(methoxymethyl)pyrrolidine;molecular hydrogen |
| SMILES | C=C/C=C\C(=C)[C@H]1CNC[C@@H]1COC.[H][H] |
| InChI | InChI=1S/C12H19NO.H2/c1-4-5-6-10(2)12-8-13-7-11(12)9-14-3;/h4-6,11-13H,1-2,7-9H2,3H3;1H/b6-5-;/t11-,12-;/m1./s1 |
| InChIKey | WVXKWWVRSQBGKB-XPTYVPDMSA-N |
| XLogP | 2.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|