About formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline
formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline (PubChem CID 142378956) has the molecular formula C19H24F3N3O2S
and a molecular weight of 415.48 g/mol. Its IUPAC name is formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline |
| PubChem CID | 142378956 |
| Molecular Formula | C19H24F3N3O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline |
| SMILES | CO.FC(F)(F)c1ccc(Nc2ccc(SN3CCCC3)cc2)cc1.NC=O |
| InChI | InChI=1S/C17H17F3N2S.CH3NO.CH4O/c18-17(19,20)13-3-5-14(6-4-13)21-15-7-9-16(10-8-15)23-22-11-1-2-12-22;2-1-3;1-2/h3-10,21H,1-2,11-12H2;1H,(H2,2,3);2H,1H3 |
| InChIKey | WFTRBESLGAGEKS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline?
The IUPAC name of formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline (CID 142378956) is formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline.
What is the SMILES notation for formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline?
The canonical SMILES for formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline is CO.FC(F)(F)c1ccc(Nc2ccc(SN3CCCC3)cc2)cc1.NC=O.
What is the InChIKey of formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline?
The InChIKey is WFTRBESLGAGEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2S.CH3NO.CH4O/c18-17(19,20)13-3-5-14(6-4-13)21-15-7-9-16(10-8-15)23-22-11-1-2-12-22;2-1-3;1-2/h3-10,21H,1-2,11-12H2;1H,(H2,2,3);2H,1H3.
What are the key properties of formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline?
formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline has a molecular weight of 415.48 g/mol, XLogP of 4.26, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;methanol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline is sourced from PubChem (CID 142378956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).