C13H29NO2 — CID 142378975
2-(5-tert-butyl-1,4-dioxan-2-yl)propan-2-amine;ethane (PubChem CID 142378975) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,4-dioxan-2-yl)propan-2-amine;ethane.
| Compound Name | 2-(5-tert-butyl-1,4-dioxan-2-yl)propan-2-amine;ethane |
|---|---|
| PubChem CID | 142378975 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2-(5-tert-butyl-1,4-dioxan-2-yl)propan-2-amine;ethane |
| SMILES | CC.CC(C)(C)C1COC(C(C)(C)N)CO1 |
| InChI | InChI=1S/C11H23NO2.C2H6/c1-10(2,3)8-6-14-9(7-13-8)11(4,5)12;1-2/h8-9H,6-7,12H2,1-5H3;1-2H3 |
| InChIKey | ONBWNNOOYZZDEN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |